7-BroMo-4H-benzo[1,4]oxazin-3-one
7-Bromo-2H-1,4-benzoxazin-3(4H)-one
CAS: 321436-06-0
Molecular Formula: C8H6BrNO2
7-BroMo-4H-benzo[1,4]oxazin-3-one - Names and Identifiers
| Name | 7-Bromo-2H-1,4-benzoxazin-3(4H)-one |
| Synonyms | BUTTPARK 120 BUTTPARK 120 7-73 7-Bromo-4H-1,4-benzoxazin-3-one 7-BroMo-4H-benzo[1,4]oxazin-3-one 7-Bromo-2H-1,4-benzoxazin-3(4H)-one 7-BROMO-2H-1,4-BENZOXAZIN-3(4H)-ONE 2H-1,4-benzoxazin-3(4H)-one, 7-bromo- -broMo-2H-benzo[b][1,4]oxazin-3(4H)-one 7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one 7-broMo-3,4-dihydro-2H-1,4-benzoxazin-3-one |
| CAS | 321436-06-0 |
| EINECS | 200-589-5 |
| InChI | InChI=1/C8H6BrNO2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11) |
7-BroMo-4H-benzo[1,4]oxazin-3-one - Physico-chemical Properties
| Molecular Formula | C8H6BrNO2 |
| Molar Mass | 228.04 |
| Density | 1.676 |
| Boling Point | 381.5±42.0 °C(Predicted) |
| Flash Point | 184.507°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 11.76±0.20(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.601 |
7-BroMo-4H-benzo[1,4]oxazin-3-one - Introduction
7-Bromo-2H-1,4-benzoxazin-3(4H)-one is an organic compound with the following properties:
1. Appearance: 7-Bromo-2H-1,4-benzoxazin-3(4H)-one is a white to light yellow solid.
2. Solubility: it can be dissolved in common organic solvents.
3. Chemical properties: it is a compound with a cyclic structure, which has the similar properties of ketone. It can undergo electrophilic addition reaction, nucleophilic substitution reaction and other organic reactions.
This compound has a wide range of uses:
1. Drug synthesis: It can be used as an organic synthesis intermediate for the synthesis of other compounds, such as the development of new drugs.
2. Pesticide: It can be used as a raw material for pesticides to prevent and control crop diseases.
3. Other applications: It can also be used in organic synthesis research and materials science.
The method for preparing 7-Bromo-2H-1,4-benzoxazin-3(4H)-one usually involves a multi-step reaction. A common method of preparation is synthesis from appropriate starting materials through a series of chemical reactions, including electrophilic substitution, oxidation, and other organic synthesis reactions.
Regarding safety information, the following should be noted when using or handling this compound:
1. Avoid skin contact: Avoid direct contact with 7-Bromo-2H-1,4-benzoxazin-3(4H)-one to prevent skin irritation or damage.
2. Avoid inhalation: It should be operated in a well-ventilated place to prevent inhalation of gas or dust.
3. Use of personal protective equipment: Wear appropriate personal protective equipment during handling, such as gloves, safety glasses and laboratory coats.
4. Storage and handling: The compound should be stored in a dry, cool place, away from fire and high temperature. Local environmental regulations should be followed when disposing of waste.
Please note that this is only general information. In actual operation or use, specific laboratory safety procedures and guidelines should be followed.
1. Appearance: 7-Bromo-2H-1,4-benzoxazin-3(4H)-one is a white to light yellow solid.
2. Solubility: it can be dissolved in common organic solvents.
3. Chemical properties: it is a compound with a cyclic structure, which has the similar properties of ketone. It can undergo electrophilic addition reaction, nucleophilic substitution reaction and other organic reactions.
This compound has a wide range of uses:
1. Drug synthesis: It can be used as an organic synthesis intermediate for the synthesis of other compounds, such as the development of new drugs.
2. Pesticide: It can be used as a raw material for pesticides to prevent and control crop diseases.
3. Other applications: It can also be used in organic synthesis research and materials science.
The method for preparing 7-Bromo-2H-1,4-benzoxazin-3(4H)-one usually involves a multi-step reaction. A common method of preparation is synthesis from appropriate starting materials through a series of chemical reactions, including electrophilic substitution, oxidation, and other organic synthesis reactions.
Regarding safety information, the following should be noted when using or handling this compound:
1. Avoid skin contact: Avoid direct contact with 7-Bromo-2H-1,4-benzoxazin-3(4H)-one to prevent skin irritation or damage.
2. Avoid inhalation: It should be operated in a well-ventilated place to prevent inhalation of gas or dust.
3. Use of personal protective equipment: Wear appropriate personal protective equipment during handling, such as gloves, safety glasses and laboratory coats.
4. Storage and handling: The compound should be stored in a dry, cool place, away from fire and high temperature. Local environmental regulations should be followed when disposing of waste.
Please note that this is only general information. In actual operation or use, specific laboratory safety procedures and guidelines should be followed.
Last Update：2024-04-09 21:21:28
![7-BroMo-4H-benzo[1,4]oxazin-3-one](http://res.chembk.com/assets/images/structure/321436-06-0.gif)
Supplier List
Product Name: BUTTPARK 120\07-73 Visit Supplier Webpage Request for quotation
CAS: 321436-06-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 321436-06-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: BUTTPARK 120\07-73 Visit Supplier Webpage Request for quotation
CAS: 321436-06-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 321436-06-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History